C22H21NOS — CID 94018618
N-[(R)-(2-methylphenyl)-phenylmethyl]-2-phenylsulfanylacetamide (PubChem CID 94018618) has the molecular formula C22H21NOS and a molecular weight of 347.48 g/mol. Its IUPAC name is N-[(R)-(2-methylphenyl)-phenylmethyl]-2-phenylsulfanylacetamide.
| Compound Name | N-[(R)-(2-methylphenyl)-phenylmethyl]-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 94018618 |
| Molecular Formula | C22H21NOS |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-[(R)-(2-methylphenyl)-phenylmethyl]-2-phenylsulfanylacetamide |
| SMILES | Cc1ccccc1[C@H](NC(=O)CSc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21NOS/c1-17-10-8-9-15-20(17)22(18-11-4-2-5-12-18)23-21(24)16-25-19-13-6-3-7-14-19/h2-15,22H,16H2,1H3,(H,23,24)/t22-/m1/s1 |
| InChIKey | JRVVVUPWTLQQSH-JOCHJYFZSA-N |
| XLogP | 4.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |