C30H31ClN4OS — CID 133243956
5-[1-(3-chlorophenyl)-2,4,5-trimethylpyrrol-3-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133243956) has the molecular formula C30H31ClN4OS and a molecular weight of 531.13 g/mol. Its IUPAC name is 5-[1-(3-chlorophenyl)-2,4,5-trimethylpyrrol-3-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(3-chlorophenyl)-2,4,5-trimethylpyrrol-3-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133243956 |
| Molecular Formula | C30H31ClN4OS |
| Molecular Weight | 531.13 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 5-[1-(3-chlorophenyl)-2,4,5-trimethylpyrrol-3-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1c(C2C(c3ccccn3)NC(=S)N2c2ccc(OC(C)C)cc2)c(C)n(-c2cccc(Cl)c2)c1C |
| InChI | InChI=1S/C30H31ClN4OS/c1-18(2)36-25-14-12-23(13-15-25)35-29(28(33-30(35)37)26-11-6-7-16-32-26)27-19(3)20(4)34(21(27)5)24-10-8-9-22(31)17-24/h6-18,28-29H,1-5H3,(H,33,37) |
| InChIKey | VGVRHTKPTKBBFT-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.13 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|