C27H26N4OS — CID 133156430
1-(4-hydroxyphenyl)-4-pyridin-2-yl-5-(2,4,5-trimethyl-1-phenylpyrrol-3-yl)imidazolidine-2-thione (PubChem CID 133156430) has the molecular formula C27H26N4OS and a molecular weight of 454.60 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)-4-pyridin-2-yl-5-(2,4,5-trimethyl-1-phenylpyrrol-3-yl)imidazolidine-2-thione.
| Compound Name | 1-(4-hydroxyphenyl)-4-pyridin-2-yl-5-(2,4,5-trimethyl-1-phenylpyrrol-3-yl)imidazolidine-2-thione |
|---|---|
| PubChem CID | 133156430 |
| Molecular Formula | C27H26N4OS |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 1-(4-hydroxyphenyl)-4-pyridin-2-yl-5-(2,4,5-trimethyl-1-phenylpyrrol-3-yl)imidazolidine-2-thione |
| SMILES | Cc1c(C2C(c3ccccn3)NC(=S)N2c2ccc(O)cc2)c(C)n(-c2ccccc2)c1C |
| InChI | InChI=1S/C27H26N4OS/c1-17-18(2)30(20-9-5-4-6-10-20)19(3)24(17)26-25(23-11-7-8-16-28-23)29-27(33)31(26)21-12-14-22(32)15-13-21/h4-16,25-26,32H,1-3H3,(H,29,33) |
| InChIKey | KHMANEPLYWCGJN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|