C24H31NO2 — CID 133244558
(E)-N-(2-ethylhexyl)-3-(4-methoxyphenyl)-2-phenylprop-2-enamide (PubChem CID 133244558) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (E)-N-(2-ethylhexyl)-3-(4-methoxyphenyl)-2-phenylprop-2-enamide.
| Compound Name | (E)-N-(2-ethylhexyl)-3-(4-methoxyphenyl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 133244558 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (E)-N-(2-ethylhexyl)-3-(4-methoxyphenyl)-2-phenylprop-2-enamide |
| SMILES | CCCCC(CC)CNC(=O)/C(=C/c1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H31NO2/c1-4-6-10-19(5-2)18-25-24(26)23(21-11-8-7-9-12-21)17-20-13-15-22(27-3)16-14-20/h7-9,11-17,19H,4-6,10,18H2,1-3H3,(H,25,26)/b23-17+ |
| InChIKey | AYZKBFLXJSLQJX-HAVVHWLPSA-N |
| XLogP | 5.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|