C30H35FN2O4 — CID 133257173
N-[(4-fluorophenyl)methyl]-4-(4-methoxyphenoxy)-N-[1-oxo-3-phenyl-1-(propan-2-ylamino)propan-2-yl]butanamide (PubChem CID 133257173) has the molecular formula C30H35FN2O4 and a molecular weight of 506.62 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-(4-methoxyphenoxy)-N-[1-oxo-3-phenyl-1-(propan-2-ylamino)propan-2-yl]butanamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-(4-methoxyphenoxy)-N-[1-oxo-3-phenyl-1-(propan-2-ylamino)propan-2-yl]butanamide |
|---|---|
| PubChem CID | 133257173 |
| Molecular Formula | C30H35FN2O4 |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-(4-methoxyphenoxy)-N-[1-oxo-3-phenyl-1-(propan-2-ylamino)propan-2-yl]butanamide |
| SMILES | COc1ccc(OCCCC(=O)N(Cc2ccc(F)cc2)C(Cc2ccccc2)C(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C30H35FN2O4/c1-22(2)32-30(35)28(20-23-8-5-4-6-9-23)33(21-24-11-13-25(31)14-12-24)29(34)10-7-19-37-27-17-15-26(36-3)16-18-27/h4-6,8-9,11-18,22,28H,7,10,19-21H2,1-3H3,(H,32,35) |
| InChIKey | DQAZEKDAFKWLQP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|