C30H35BrN2O2S — CID 133259209
2-[3-benzylsulfanylpropanoyl-[(4-bromophenyl)methyl]amino]-N-butan-2-yl-3-phenylpropanamide (PubChem CID 133259209) has the molecular formula C30H35BrN2O2S and a molecular weight of 567.59 g/mol. Its IUPAC name is 2-[3-benzylsulfanylpropanoyl-[(4-bromophenyl)methyl]amino]-N-butan-2-yl-3-phenylpropanamide.
| Compound Name | 2-[3-benzylsulfanylpropanoyl-[(4-bromophenyl)methyl]amino]-N-butan-2-yl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133259209 |
| Molecular Formula | C30H35BrN2O2S |
| Molecular Weight | 567.59 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | 2-[3-benzylsulfanylpropanoyl-[(4-bromophenyl)methyl]amino]-N-butan-2-yl-3-phenylpropanamide |
| SMILES | CCC(C)NC(=O)C(Cc1ccccc1)N(Cc1ccc(Br)cc1)C(=O)CCSCc1ccccc1 |
| InChI | InChI=1S/C30H35BrN2O2S/c1-3-23(2)32-30(35)28(20-24-10-6-4-7-11-24)33(21-25-14-16-27(31)17-15-25)29(34)18-19-36-22-26-12-8-5-9-13-26/h4-17,23,28H,3,18-22H2,1-2H3,(H,32,35) |
| InChIKey | KENMWRDWZCDHPC-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.59 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|