C13H21N5O2 — CID 133260673
N-[(1S,5S,6R,7S)-7-(dimethylamino)-2-oxabicyclo[3.2.0]heptan-6-yl]-3-(1,2,4-triazol-1-yl)propanamide (PubChem CID 133260673) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[(1S,5S,6R,7S)-7-(dimethylamino)-2-oxabicyclo[3.2.0]heptan-6-yl]-3-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-[(1S,5S,6R,7S)-7-(dimethylamino)-2-oxabicyclo[3.2.0]heptan-6-yl]-3-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 133260673 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N-[(1S,5S,6R,7S)-7-(dimethylamino)-2-oxabicyclo[3.2.0]heptan-6-yl]-3-(1,2,4-triazol-1-yl)propanamide |
| SMILES | CN(C)[C@H]1[C@H](NC(=O)CCn2cncn2)[C@@H]2CCO[C@@H]21 |
| InChI | InChI=1S/C13H21N5O2/c1-17(2)12-11(9-4-6-20-13(9)12)16-10(19)3-5-18-8-14-7-15-18/h7-9,11-13H,3-6H2,1-2H3,(H,16,19)/t9-,11+,12-,13-/m0/s1 |
| InChIKey | XVHZYFULSMESEV-RYDUCSDGSA-N |
| XLogP | -0.50 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |