C14H17N3O — CID 133264534
trans-(1R,2R)-2-(2-pyridin-3-ylimidazol-1-yl)cyclohexan-1-ol (PubChem CID 133264534) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is trans-(1R,2R)-2-(2-pyridin-3-ylimidazol-1-yl)cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-(2-pyridin-3-ylimidazol-1-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 133264534 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | trans-(1R,2R)-2-(2-pyridin-3-ylimidazol-1-yl)cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@H]1n1ccnc1-c1cccnc1 |
| InChI | InChI=1S/C14H17N3O/c18-13-6-2-1-5-12(13)17-9-8-16-14(17)11-4-3-7-15-10-11/h3-4,7-10,12-13,18H,1-2,5-6H2/t12-,13-/m1/s1 |
| InChIKey | UYNWCLHQHVODTM-CHWSQXEVSA-N |
| XLogP | 2.42 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |