C21H27N3O — CID 171155950
(3aS,5S,6S,7aR)-2-cyclobutyl-6-(2-phenylimidazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 171155950) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is (3aS,5S,6S,7aR)-2-cyclobutyl-6-(2-phenylimidazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aS,5S,6S,7aR)-2-cyclobutyl-6-(2-phenylimidazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 171155950 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | (3aS,5S,6S,7aR)-2-cyclobutyl-6-(2-phenylimidazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | O[C@H]1C[C@@H]2CN(C3CCC3)C[C@@H]2C[C@@H]1n1ccnc1-c1ccccc1 |
| InChI | InChI=1S/C21H27N3O/c25-20-12-17-14-23(18-7-4-8-18)13-16(17)11-19(20)24-10-9-22-21(24)15-5-2-1-3-6-15/h1-3,5-6,9-10,16-20,25H,4,7-8,11-14H2/t16-,17+,19-,20-/m0/s1 |
| InChIKey | FIPDVAKIVMOSDE-HNJRGHQBSA-N |
| XLogP | 3.35 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |