C16H19IN2 — CID 79787135
2-(3-iodophenyl)-1-(3-methylcyclohexyl)imidazole (PubChem CID 79787135) has the molecular formula C16H19IN2 and a molecular weight of 366.25 g/mol. Its IUPAC name is 2-(3-iodophenyl)-1-(3-methylcyclohexyl)imidazole.
| Compound Name | 2-(3-iodophenyl)-1-(3-methylcyclohexyl)imidazole |
|---|---|
| PubChem CID | 79787135 |
| Molecular Formula | C16H19IN2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-(3-iodophenyl)-1-(3-methylcyclohexyl)imidazole |
| SMILES | CC1CCCC(n2ccnc2-c2cccc(I)c2)C1 |
| InChI | InChI=1S/C16H19IN2/c1-12-4-2-7-15(10-12)19-9-8-18-16(19)13-5-3-6-14(17)11-13/h3,5-6,8-9,11-12,15H,2,4,7,10H2,1H3 |
| InChIKey | STUZQVVSJVFMQF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|