C17H20F3N3 — CID 154566736
(2S,4R)-2-ethyl-4-[2-[3-(trifluoromethyl)phenyl]imidazol-1-yl]piperidine (PubChem CID 154566736) has the molecular formula C17H20F3N3 and a molecular weight of 323.36 g/mol. Its IUPAC name is (2S,4R)-2-ethyl-4-[2-[3-(trifluoromethyl)phenyl]imidazol-1-yl]piperidine.
| Compound Name | (2S,4R)-2-ethyl-4-[2-[3-(trifluoromethyl)phenyl]imidazol-1-yl]piperidine |
|---|---|
| PubChem CID | 154566736 |
| Molecular Formula | C17H20F3N3 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (2S,4R)-2-ethyl-4-[2-[3-(trifluoromethyl)phenyl]imidazol-1-yl]piperidine |
| SMILES | CC[C@H]1C[C@H](n2ccnc2-c2cccc(C(F)(F)F)c2)CCN1 |
| InChI | InChI=1S/C17H20F3N3/c1-2-14-11-15(6-7-21-14)23-9-8-22-16(23)12-4-3-5-13(10-12)17(18,19)20/h3-5,8-10,14-15,21H,2,6-7,11H2,1H3/t14-,15+/m0/s1 |
| InChIKey | LUMAAUPZUSHLCL-LSDHHAIUSA-N |
| XLogP | 4.27 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |