C20H28N2O3 — CID 154919518
cis-(1S,3R)-3-[2-(4-butylphenyl)imidazol-1-yl]cyclohexan-1-ol;formic acid (PubChem CID 154919518) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is cis-(1S,3R)-3-[2-(4-butylphenyl)imidazol-1-yl]cyclohexan-1-ol;formic acid.
| Compound Name | cis-(1S,3R)-3-[2-(4-butylphenyl)imidazol-1-yl]cyclohexan-1-ol;formic acid |
|---|---|
| PubChem CID | 154919518 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | cis-(1S,3R)-3-[2-(4-butylphenyl)imidazol-1-yl]cyclohexan-1-ol;formic acid |
| SMILES | CCCCc1ccc(-c2nccn2[C@@H]2CCC[C@H](O)C2)cc1.O=CO |
| InChI | InChI=1S/C19H26N2O.CH2O2/c1-2-3-5-15-8-10-16(11-9-15)19-20-12-13-21(19)17-6-4-7-18(22)14-17;2-1-3/h8-13,17-18,22H,2-7,14H2,1H3;1H,(H,2,3)/t17-,18+;/m1./s1 |
| InChIKey | AQZDPLOFKPXAOY-URBRKQAFSA-N |
| XLogP | 4.07 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|