C19H24N2O4 — CID 155940361
2-(4-cyclopentyloxyphenyl)-1-(oxolan-3-yl)imidazole;formic acid (PubChem CID 155940361) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-(4-cyclopentyloxyphenyl)-1-(oxolan-3-yl)imidazole;formic acid.
| Compound Name | 2-(4-cyclopentyloxyphenyl)-1-(oxolan-3-yl)imidazole;formic acid |
|---|---|
| PubChem CID | 155940361 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-(4-cyclopentyloxyphenyl)-1-(oxolan-3-yl)imidazole;formic acid |
| SMILES | O=CO.c1cn(C2CCOC2)c(-c2ccc(OC3CCCC3)cc2)n1 |
| InChI | InChI=1S/C18H22N2O2.CH2O2/c1-2-4-16(3-1)22-17-7-5-14(6-8-17)18-19-10-11-20(18)15-9-12-21-13-15;2-1-3/h5-8,10-11,15-16H,1-4,9,12-13H2;1H,(H,2,3) |
| InChIKey | RIQNNDBFCSMAIW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|