C21H23N3O3 — CID 171708775
formic acid;4-[[(3S,4S)-4-[2-(4-methylphenyl)imidazol-1-yl]oxolan-3-yl]methyl]pyridine (PubChem CID 171708775) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is formic acid;4-[[(3S,4S)-4-[2-(4-methylphenyl)imidazol-1-yl]oxolan-3-yl]methyl]pyridine.
| Compound Name | formic acid;4-[[(3S,4S)-4-[2-(4-methylphenyl)imidazol-1-yl]oxolan-3-yl]methyl]pyridine |
|---|---|
| PubChem CID | 171708775 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | formic acid;4-[[(3S,4S)-4-[2-(4-methylphenyl)imidazol-1-yl]oxolan-3-yl]methyl]pyridine |
| SMILES | Cc1ccc(-c2nccn2[C@@H]2COC[C@H]2Cc2ccncc2)cc1.O=CO |
| InChI | InChI=1S/C20H21N3O.CH2O2/c1-15-2-4-17(5-3-15)20-22-10-11-23(20)19-14-24-13-18(19)12-16-6-8-21-9-7-16;2-1-3/h2-11,18-19H,12-14H2,1H3;1H,(H,2,3)/t18-,19-;/m1./s1 |
| InChIKey | SXTNBGGQFOXDFI-STYNFMPRSA-N |
| XLogP | 3.38 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|