C19H23N5O3 — CID 171706955
4-[[(3R,4S)-4-[2-(3-ethylimidazol-4-yl)imidazol-1-yl]oxolan-3-yl]methyl]pyridine;formic acid (PubChem CID 171706955) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is 4-[[(3R,4S)-4-[2-(3-ethylimidazol-4-yl)imidazol-1-yl]oxolan-3-yl]methyl]pyridine;formic acid.
| Compound Name | 4-[[(3R,4S)-4-[2-(3-ethylimidazol-4-yl)imidazol-1-yl]oxolan-3-yl]methyl]pyridine;formic acid |
|---|---|
| PubChem CID | 171706955 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 4-[[(3R,4S)-4-[2-(3-ethylimidazol-4-yl)imidazol-1-yl]oxolan-3-yl]methyl]pyridine;formic acid |
| SMILES | CCn1cncc1-c1nccn1[C@@H]1COC[C@@H]1Cc1ccncc1.O=CO |
| InChI | InChI=1S/C18H21N5O.CH2O2/c1-2-22-13-20-10-16(22)18-21-7-8-23(18)17-12-24-11-15(17)9-14-3-5-19-6-4-14;2-1-3/h3-8,10,13,15,17H,2,9,11-12H2,1H3;1H,(H,2,3)/t15-,17+;/m0./s1 |
| InChIKey | HJUJHWCDJWQYLH-KPVRICSOSA-N |
| XLogP | 2.29 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|