C22H26N4O3 — CID 171711936
N,N-dimethyl-4-[1-[(3S,4R)-4-(pyridin-4-ylmethyl)oxolan-3-yl]imidazol-2-yl]aniline;formic acid (PubChem CID 171711936) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is N,N-dimethyl-4-[1-[(3S,4R)-4-(pyridin-4-ylmethyl)oxolan-3-yl]imidazol-2-yl]aniline;formic acid.
| Compound Name | N,N-dimethyl-4-[1-[(3S,4R)-4-(pyridin-4-ylmethyl)oxolan-3-yl]imidazol-2-yl]aniline;formic acid |
|---|---|
| PubChem CID | 171711936 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N,N-dimethyl-4-[1-[(3S,4R)-4-(pyridin-4-ylmethyl)oxolan-3-yl]imidazol-2-yl]aniline;formic acid |
| SMILES | CN(C)c1ccc(-c2nccn2[C@@H]2COC[C@@H]2Cc2ccncc2)cc1.O=CO |
| InChI | InChI=1S/C21H24N4O.CH2O2/c1-24(2)19-5-3-17(4-6-19)21-23-11-12-25(21)20-15-26-14-18(20)13-16-7-9-22-10-8-16;2-1-3/h3-12,18,20H,13-15H2,1-2H3;1H,(H,2,3)/t18-,20+;/m0./s1 |
| InChIKey | KVXVEANMZAEAQQ-VKLKMBQZSA-N |
| XLogP | 3.14 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|