C19H28N4O5S — CID 166599392
1-[(3S,4S)-4-[2-[4-(dimethylamino)phenyl]imidazol-1-yl]oxolan-3-yl]-N,N-dimethylmethanesulfonamide;formic acid (PubChem CID 166599392) has the molecular formula C19H28N4O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is 1-[(3S,4S)-4-[2-[4-(dimethylamino)phenyl]imidazol-1-yl]oxolan-3-yl]-N,N-dimethylmethanesulfonamide;formic acid.
| Compound Name | 1-[(3S,4S)-4-[2-[4-(dimethylamino)phenyl]imidazol-1-yl]oxolan-3-yl]-N,N-dimethylmethanesulfonamide;formic acid |
|---|---|
| PubChem CID | 166599392 |
| Molecular Formula | C19H28N4O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 1-[(3S,4S)-4-[2-[4-(dimethylamino)phenyl]imidazol-1-yl]oxolan-3-yl]-N,N-dimethylmethanesulfonamide;formic acid |
| SMILES | CN(C)c1ccc(-c2nccn2[C@@H]2COC[C@H]2CS(=O)(=O)N(C)C)cc1.O=CO |
| InChI | InChI=1S/C18H26N4O3S.CH2O2/c1-20(2)16-7-5-14(6-8-16)18-19-9-10-22(18)17-12-25-11-15(17)13-26(23,24)21(3)4;2-1-3/h5-10,15,17H,11-13H2,1-4H3;1H,(H,2,3)/t15-,17+;/m0./s1 |
| InChIKey | KOJOUQZZQMMHIC-KPVRICSOSA-N |
| XLogP | 1.40 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|