C20H24N4O5S — CID 166598033
N,N-dimethyl-1-[(3S,4S)-4-(2-quinolin-2-ylimidazol-1-yl)oxolan-3-yl]methanesulfonamide;formic acid (PubChem CID 166598033) has the molecular formula C20H24N4O5S and a molecular weight of 432.50 g/mol. Its IUPAC name is N,N-dimethyl-1-[(3S,4S)-4-(2-quinolin-2-ylimidazol-1-yl)oxolan-3-yl]methanesulfonamide;formic acid.
| Compound Name | N,N-dimethyl-1-[(3S,4S)-4-(2-quinolin-2-ylimidazol-1-yl)oxolan-3-yl]methanesulfonamide;formic acid |
|---|---|
| PubChem CID | 166598033 |
| Molecular Formula | C20H24N4O5S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N,N-dimethyl-1-[(3S,4S)-4-(2-quinolin-2-ylimidazol-1-yl)oxolan-3-yl]methanesulfonamide;formic acid |
| SMILES | CN(C)S(=O)(=O)C[C@@H]1COC[C@H]1n1ccnc1-c1ccc2ccccc2n1.O=CO |
| InChI | InChI=1S/C19H22N4O3S.CH2O2/c1-22(2)27(24,25)13-15-11-26-12-18(15)23-10-9-20-19(23)17-8-7-14-5-3-4-6-16(14)21-17;2-1-3/h3-10,15,18H,11-13H2,1-2H3;1H,(H,2,3)/t15-,18+;/m0./s1 |
| InChIKey | RLCWEOYVGMEMCA-QVNYQEOOSA-N |
| XLogP | 1.88 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|