C21H26N4O5S — CID 171322527
N,N-dimethyl-1-[(3S,4S)-4-[2-(8-methylquinolin-5-yl)imidazol-1-yl]oxolan-3-yl]methanesulfonamide;formic acid (PubChem CID 171322527) has the molecular formula C21H26N4O5S and a molecular weight of 446.53 g/mol. Its IUPAC name is N,N-dimethyl-1-[(3S,4S)-4-[2-(8-methylquinolin-5-yl)imidazol-1-yl]oxolan-3-yl]methanesulfonamide;formic acid.
| Compound Name | N,N-dimethyl-1-[(3S,4S)-4-[2-(8-methylquinolin-5-yl)imidazol-1-yl]oxolan-3-yl]methanesulfonamide;formic acid |
|---|---|
| PubChem CID | 171322527 |
| Molecular Formula | C21H26N4O5S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | N,N-dimethyl-1-[(3S,4S)-4-[2-(8-methylquinolin-5-yl)imidazol-1-yl]oxolan-3-yl]methanesulfonamide;formic acid |
| SMILES | Cc1ccc(-c2nccn2[C@@H]2COC[C@H]2CS(=O)(=O)N(C)C)c2cccnc12.O=CO |
| InChI | InChI=1S/C20H24N4O3S.CH2O2/c1-14-6-7-17(16-5-4-8-21-19(14)16)20-22-9-10-24(20)18-12-27-11-15(18)13-28(25,26)23(2)3;2-1-3/h4-10,15,18H,11-13H2,1-3H3;1H,(H,2,3)/t15-,18+;/m0./s1 |
| InChIKey | LNBBHVLBVPHCDU-QVNYQEOOSA-N |
| XLogP | 2.19 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|