C20H25N5O5S — CID 171330235
N,N-dimethyl-1-[(3R,4S)-4-[2-(3-pyrazol-1-ylphenyl)imidazol-1-yl]oxolan-3-yl]methanesulfonamide;formic acid (PubChem CID 171330235) has the molecular formula C20H25N5O5S and a molecular weight of 447.52 g/mol. Its IUPAC name is N,N-dimethyl-1-[(3R,4S)-4-[2-(3-pyrazol-1-ylphenyl)imidazol-1-yl]oxolan-3-yl]methanesulfonamide;formic acid.
| Compound Name | N,N-dimethyl-1-[(3R,4S)-4-[2-(3-pyrazol-1-ylphenyl)imidazol-1-yl]oxolan-3-yl]methanesulfonamide;formic acid |
|---|---|
| PubChem CID | 171330235 |
| Molecular Formula | C20H25N5O5S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N,N-dimethyl-1-[(3R,4S)-4-[2-(3-pyrazol-1-ylphenyl)imidazol-1-yl]oxolan-3-yl]methanesulfonamide;formic acid |
| SMILES | CN(C)S(=O)(=O)C[C@H]1COC[C@H]1n1ccnc1-c1cccc(-n2cccn2)c1.O=CO |
| InChI | InChI=1S/C19H23N5O3S.CH2O2/c1-22(2)28(25,26)14-16-12-27-13-18(16)23-10-8-20-19(23)15-5-3-6-17(11-15)24-9-4-7-21-24;2-1-3/h3-11,16,18H,12-14H2,1-2H3;1H,(H,2,3)/t16-,18-;/m1./s1 |
| InChIKey | OGEVMQKXRPEPJW-PHJLCXHGSA-N |
| XLogP | 1.52 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|