C17H21N3O4S — CID 135120217
N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]isoquinoline-1-carboxamide (PubChem CID 135120217) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]isoquinoline-1-carboxamide.
| Compound Name | N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 135120217 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | N-[(3R,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]isoquinoline-1-carboxamide |
| SMILES | CN(C)S(=O)(=O)C[C@@H]1COC[C@@H]1NC(=O)c1nccc2ccccc12 |
| InChI | InChI=1S/C17H21N3O4S/c1-20(2)25(22,23)11-13-9-24-10-15(13)19-17(21)16-14-6-4-3-5-12(14)7-8-18-16/h3-8,13,15H,9-11H2,1-2H3,(H,19,21)/t13-,15-/m0/s1 |
| InChIKey | PGLKANZBKJCGGL-ZFWWWQNUSA-N |
| XLogP | 0.87 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |