C21H27N3O5 — CID 154823819
2-[2-methoxy-4-[1-(oxan-4-yl)imidazol-2-yl]phenoxy]-1-morpholin-4-ylethanone (PubChem CID 154823819) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-[2-methoxy-4-[1-(oxan-4-yl)imidazol-2-yl]phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[2-methoxy-4-[1-(oxan-4-yl)imidazol-2-yl]phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 154823819 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 2-[2-methoxy-4-[1-(oxan-4-yl)imidazol-2-yl]phenoxy]-1-morpholin-4-ylethanone |
| SMILES | COc1cc(-c2nccn2C2CCOCC2)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H27N3O5/c1-26-19-14-16(21-22-6-7-24(21)17-4-10-27-11-5-17)2-3-18(19)29-15-20(25)23-8-12-28-13-9-23/h2-3,6-7,14,17H,4-5,8-13,15H2,1H3 |
| InChIKey | UNAXASMSTLYTAS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 75.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |