C21H23N3O4 — CID 154923864
formic acid;2-[[4-[1-(oxan-4-yl)imidazol-2-yl]phenoxy]methyl]pyridine (PubChem CID 154923864) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is formic acid;2-[[4-[1-(oxan-4-yl)imidazol-2-yl]phenoxy]methyl]pyridine.
| Compound Name | formic acid;2-[[4-[1-(oxan-4-yl)imidazol-2-yl]phenoxy]methyl]pyridine |
|---|---|
| PubChem CID | 154923864 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | formic acid;2-[[4-[1-(oxan-4-yl)imidazol-2-yl]phenoxy]methyl]pyridine |
| SMILES | O=CO.c1ccc(COc2ccc(-c3nccn3C3CCOCC3)cc2)nc1 |
| InChI | InChI=1S/C20H21N3O2.CH2O2/c1-2-10-21-17(3-1)15-25-19-6-4-16(5-7-19)20-22-11-12-23(20)18-8-13-24-14-9-18;2-1-3/h1-7,10-12,18H,8-9,13-15H2;1H,(H,2,3) |
| InChIKey | LZTGRXQQAVSLPO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|