C21H20N2O5 — CID 67810036
2-morpholin-4-yl-6-[4-(pyridin-2-ylmethoxy)phenyl]pyran-3,4-dione (PubChem CID 67810036) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-morpholin-4-yl-6-[4-(pyridin-2-ylmethoxy)phenyl]pyran-3,4-dione.
| Compound Name | 2-morpholin-4-yl-6-[4-(pyridin-2-ylmethoxy)phenyl]pyran-3,4-dione |
|---|---|
| PubChem CID | 67810036 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 2-morpholin-4-yl-6-[4-(pyridin-2-ylmethoxy)phenyl]pyran-3,4-dione |
| SMILES | O=C1C=C(c2ccc(OCc3ccccn3)cc2)OC(N2CCOCC2)C1=O |
| InChI | InChI=1S/C21H20N2O5/c24-18-13-19(28-21(20(18)25)23-9-11-26-12-10-23)15-4-6-17(7-5-15)27-14-16-3-1-2-8-22-16/h1-8,13,21H,9-12,14H2 |
| InChIKey | XZIWABTVYDSLCF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|