C23H20N2O5 — CID 58923370
1-hydroxy-3-morpholin-4-yl-6-(pyridin-2-ylmethoxy)xanthen-9-one (PubChem CID 58923370) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is 1-hydroxy-3-morpholin-4-yl-6-(pyridin-2-ylmethoxy)xanthen-9-one.
| Compound Name | 1-hydroxy-3-morpholin-4-yl-6-(pyridin-2-ylmethoxy)xanthen-9-one |
|---|---|
| PubChem CID | 58923370 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 1-hydroxy-3-morpholin-4-yl-6-(pyridin-2-ylmethoxy)xanthen-9-one |
| SMILES | O=c1c2ccc(OCc3ccccn3)cc2oc2cc(N3CCOCC3)cc(O)c12 |
| InChI | InChI=1S/C23H20N2O5/c26-19-11-16(25-7-9-28-10-8-25)12-21-22(19)23(27)18-5-4-17(13-20(18)30-21)29-14-15-3-1-2-6-24-15/h1-6,11-13,26H,7-10,14H2 |
| InChIKey | YTJQAJUJODBHOR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|