C21H24NO7P — CID 89457464
6-(2-dimethylphosphoryloxyethoxy)-1-hydroxy-3-morpholin-4-ylxanthen-9-one (PubChem CID 89457464) has the molecular formula C21H24NO7P and a molecular weight of 433.40 g/mol. Its IUPAC name is 6-(2-dimethylphosphoryloxyethoxy)-1-hydroxy-3-morpholin-4-ylxanthen-9-one.
| Compound Name | 6-(2-dimethylphosphoryloxyethoxy)-1-hydroxy-3-morpholin-4-ylxanthen-9-one |
|---|---|
| PubChem CID | 89457464 |
| Molecular Formula | C21H24NO7P |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 6-(2-dimethylphosphoryloxyethoxy)-1-hydroxy-3-morpholin-4-ylxanthen-9-one |
| SMILES | CP(C)(=O)OCCOc1ccc2c(=O)c3c(O)cc(N4CCOCC4)cc3oc2c1 |
| InChI | InChI=1S/C21H24NO7P/c1-30(2,25)28-10-9-27-15-3-4-16-18(13-15)29-19-12-14(22-5-7-26-8-6-22)11-17(23)20(19)21(16)24/h3-4,11-13,23H,5-10H2,1-2H3 |
| InChIKey | GWSIFOLLAUCADY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|