C17H14ClNO5 — CID 6226184
2-(6-chloro-1-hydroxy-9-oxoxanthen-3-yl)oxy-N,N-dimethylacetamide (PubChem CID 6226184) has the molecular formula C17H14ClNO5 and a molecular weight of 347.75 g/mol. Its IUPAC name is 2-(6-chloro-1-hydroxy-9-oxoxanthen-3-yl)oxy-N,N-dimethylacetamide.
| Compound Name | 2-(6-chloro-1-hydroxy-9-oxoxanthen-3-yl)oxy-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 6226184 |
| Molecular Formula | C17H14ClNO5 |
| Molecular Weight | 347.75 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 2-(6-chloro-1-hydroxy-9-oxoxanthen-3-yl)oxy-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)COc1cc(O)c2c(=O)c3ccc(Cl)cc3oc2c1 |
| InChI | InChI=1S/C17H14ClNO5/c1-19(2)15(21)8-23-10-6-12(20)16-14(7-10)24-13-5-9(18)3-4-11(13)17(16)22/h3-7,20H,8H2,1-2H3 |
| InChIKey | DAJGCOUHPBVIKM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.75 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|