C28H25N3O5 — CID 55623065
(E)-N-[2-(morpholine-4-carbonyl)-1-benzofuran-3-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enamide (PubChem CID 55623065) has the molecular formula C28H25N3O5 and a molecular weight of 483.52 g/mol. Its IUPAC name is (E)-N-[2-(morpholine-4-carbonyl)-1-benzofuran-3-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-(morpholine-4-carbonyl)-1-benzofuran-3-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55623065 |
| Molecular Formula | C28H25N3O5 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | (E)-N-[2-(morpholine-4-carbonyl)-1-benzofuran-3-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(OCc2ccccn2)cc1)Nc1c(C(=O)N2CCOCC2)oc2ccccc12 |
| InChI | InChI=1S/C28H25N3O5/c32-25(13-10-20-8-11-22(12-9-20)35-19-21-5-3-4-14-29-21)30-26-23-6-1-2-7-24(23)36-27(26)28(33)31-15-17-34-18-16-31/h1-14H,15-19H2,(H,30,32)/b13-10+ |
| InChIKey | XPLQPBXUKOKSRC-JLHYYAGUSA-N |
| XLogP | 4.53 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|