C24H24N4O4 — CID 55971705
(E)-1-[4-(3-methyl-1,2-oxazole-5-carbonyl)piperazin-1-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-en-1-one (PubChem CID 55971705) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is (E)-1-[4-(3-methyl-1,2-oxazole-5-carbonyl)piperazin-1-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(3-methyl-1,2-oxazole-5-carbonyl)piperazin-1-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 55971705 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | (E)-1-[4-(3-methyl-1,2-oxazole-5-carbonyl)piperazin-1-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-en-1-one |
| SMILES | Cc1cc(C(=O)N2CCN(C(=O)/C=C/c3ccc(OCc4ccccn4)cc3)CC2)on1 |
| InChI | InChI=1S/C24H24N4O4/c1-18-16-22(32-26-18)24(30)28-14-12-27(13-15-28)23(29)10-7-19-5-8-21(9-6-19)31-17-20-4-2-3-11-25-20/h2-11,16H,12-15,17H2,1H3/b10-7+ |
| InChIKey | GQUXMMDEWLUCAZ-JXMROGBWSA-N |
| XLogP | 2.95 |
| TPSA | 88.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|