C27H25N3O2S — CID 46547250
(E)-1-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-en-1-one (PubChem CID 46547250) has the molecular formula C27H25N3O2S and a molecular weight of 455.58 g/mol. Its IUPAC name is (E)-1-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 46547250 |
| Molecular Formula | C27H25N3O2S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | (E)-1-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(OCc2ccccn2)cc1)N1CCC(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C27H25N3O2S/c31-26(13-10-20-8-11-23(12-9-20)32-19-22-5-3-4-16-28-22)30-17-14-21(15-18-30)27-29-24-6-1-2-7-25(24)33-27/h1-13,16,21H,14-15,17-19H2/b13-10+ |
| InChIKey | BLPKFWUOSMNLQT-JLHYYAGUSA-N |
| XLogP | 5.69 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|