C24H25N3O3S2 — CID 38964172
4-[(E)-3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-oxoprop-1-enyl]-N-cyclopropylbenzenesulfonamide (PubChem CID 38964172) has the molecular formula C24H25N3O3S2 and a molecular weight of 467.62 g/mol. Its IUPAC name is 4-[(E)-3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-oxoprop-1-enyl]-N-cyclopropylbenzenesulfonamide.
| Compound Name | 4-[(E)-3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-oxoprop-1-enyl]-N-cyclopropylbenzenesulfonamide |
|---|---|
| PubChem CID | 38964172 |
| Molecular Formula | C24H25N3O3S2 |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 4-[(E)-3-[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-3-oxoprop-1-enyl]-N-cyclopropylbenzenesulfonamide |
| SMILES | O=C(/C=C/c1ccc(S(=O)(=O)NC2CC2)cc1)N1CCC(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C24H25N3O3S2/c28-23(12-7-17-5-10-20(11-6-17)32(29,30)26-19-8-9-19)27-15-13-18(14-16-27)24-25-21-3-1-2-4-22(21)31-24/h1-7,10-12,18-19,26H,8-9,13-16H2/b12-7+ |
| InChIKey | GBCLEFVDESVSHR-KPKJPENVSA-N |
| XLogP | 4.16 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|