C17H15N3O3S2 — CID 35998693
N-(1,3-benzothiazol-2-yl)-4-(cyclopropylsulfamoyl)benzamide (PubChem CID 35998693) has the molecular formula C17H15N3O3S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-(cyclopropylsulfamoyl)benzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-(cyclopropylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 35998693 |
| Molecular Formula | C17H15N3O3S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-(cyclopropylsulfamoyl)benzamide |
| SMILES | O=C(Nc1nc2ccccc2s1)c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C17H15N3O3S2/c21-16(19-17-18-14-3-1-2-4-15(14)24-17)11-5-9-13(10-6-11)25(22,23)20-12-7-8-12/h1-6,9-10,12,20H,7-8H2,(H,18,19,21) |
| InChIKey | XYUPQLQRAUKUAR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |