C26H23Cl2N3O3 — CID 46399510
(E)-1-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-en-1-one (PubChem CID 46399510) has the molecular formula C26H23Cl2N3O3 and a molecular weight of 496.39 g/mol. Its IUPAC name is (E)-1-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 46399510 |
| Molecular Formula | C26H23Cl2N3O3 |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | (E)-1-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-3-[4-(pyridin-2-ylmethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(OCc2ccccn2)cc1)N1CCN(C(=O)c2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C26H23Cl2N3O3/c27-21-15-20(16-22(28)17-21)26(33)31-13-11-30(12-14-31)25(32)9-6-19-4-7-24(8-5-19)34-18-23-3-1-2-10-29-23/h1-10,15-17H,11-14,18H2/b9-6+ |
| InChIKey | IHAKQLRMAIIHCT-RMKNXTFCSA-N |
| XLogP | 4.97 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|