C21H22N2O3 — CID 43009269
pyridin-2-ylmethyl 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate (PubChem CID 43009269) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is pyridin-2-ylmethyl 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate.
| Compound Name | pyridin-2-ylmethyl 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 43009269 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | pyridin-2-ylmethyl 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate |
| SMILES | O=C(OCc1ccccn1)C1CCN(C(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C21H22N2O3/c24-20(10-9-17-6-2-1-3-7-17)23-14-11-18(12-15-23)21(25)26-16-19-8-4-5-13-22-19/h1-10,13,18H,11-12,14-16H2/b10-9+ |
| InChIKey | YIGNKHIIFAGXEE-MDZDMXLPSA-N |
| XLogP | 3.08 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|