C18H22N2O4 — CID 46792726
(1-amino-1-oxopropan-2-yl) 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate (PubChem CID 46792726) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is (1-amino-1-oxopropan-2-yl) 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate.
| Compound Name | (1-amino-1-oxopropan-2-yl) 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 46792726 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (1-amino-1-oxopropan-2-yl) 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate |
| SMILES | CC(OC(=O)C1CCN(C(=O)/C=C/c2ccccc2)CC1)C(N)=O |
| InChI | InChI=1S/C18H22N2O4/c1-13(17(19)22)24-18(23)15-9-11-20(12-10-15)16(21)8-7-14-5-3-2-4-6-14/h2-8,13,15H,9-12H2,1H3,(H2,19,22)/b8-7+ |
| InChIKey | BMCDETNJXTZRJM-BQYQJAHWSA-N |
| XLogP | 1.36 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|