C24H23F3N2O4 — CID 46792704
[1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate (PubChem CID 46792704) has the molecular formula C24H23F3N2O4 and a molecular weight of 460.45 g/mol. Its IUPAC name is [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate.
| Compound Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 46792704 |
| Molecular Formula | C24H23F3N2O4 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate |
| SMILES | CC(OC(=O)C1CCN(C(=O)/C=C/c2ccccc2)CC1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C24H23F3N2O4/c1-15(23(31)28-19-9-8-18(25)21(26)22(19)27)33-24(32)17-11-13-29(14-12-17)20(30)10-7-16-5-3-2-4-6-16/h2-10,15,17H,11-14H2,1H3,(H,28,31)/b10-7+ |
| InChIKey | CQYYIVXMFGSBTA-JXMROGBWSA-N |
| XLogP | 3.93 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|