C18H20N4O3 — CID 163333896
formic acid;1-(oxolan-3-yl)-2-[3-(pyrazol-1-ylmethyl)phenyl]imidazole (PubChem CID 163333896) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is formic acid;1-(oxolan-3-yl)-2-[3-(pyrazol-1-ylmethyl)phenyl]imidazole.
| Compound Name | formic acid;1-(oxolan-3-yl)-2-[3-(pyrazol-1-ylmethyl)phenyl]imidazole |
|---|---|
| PubChem CID | 163333896 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | formic acid;1-(oxolan-3-yl)-2-[3-(pyrazol-1-ylmethyl)phenyl]imidazole |
| SMILES | O=CO.c1cc(Cn2cccn2)cc(-c2nccn2C2CCOC2)c1 |
| InChI | InChI=1S/C17H18N4O.CH2O2/c1-3-14(12-20-8-2-6-19-20)11-15(4-1)17-18-7-9-21(17)16-5-10-22-13-16;2-1-3/h1-4,6-9,11,16H,5,10,12-13H2;1H,(H,2,3) |
| InChIKey | JRZZRALJABUYSV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|