C20H24N4O3 — CID 163333857
3,5-dimethyl-1-[3-[1-(oxan-4-yl)imidazol-2-yl]phenyl]pyrazole;formic acid (PubChem CID 163333857) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 3,5-dimethyl-1-[3-[1-(oxan-4-yl)imidazol-2-yl]phenyl]pyrazole;formic acid.
| Compound Name | 3,5-dimethyl-1-[3-[1-(oxan-4-yl)imidazol-2-yl]phenyl]pyrazole;formic acid |
|---|---|
| PubChem CID | 163333857 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 3,5-dimethyl-1-[3-[1-(oxan-4-yl)imidazol-2-yl]phenyl]pyrazole;formic acid |
| SMILES | Cc1cc(C)n(-c2cccc(-c3nccn3C3CCOCC3)c2)n1.O=CO |
| InChI | InChI=1S/C19H22N4O.CH2O2/c1-14-12-15(2)23(21-14)18-5-3-4-16(13-18)19-20-8-9-22(19)17-6-10-24-11-7-17;2-1-3/h3-5,8-9,12-13,17H,6-7,10-11H2,1-2H3;1H,(H,2,3) |
| InChIKey | IPITTYUJMAAHPW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|