C22H27N3O5 — CID 13326622
ethyl 5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-6-ethyl-2-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 13326622) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is ethyl 5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-6-ethyl-2-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | ethyl 5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-6-ethyl-2-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 13326622 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | ethyl 5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-6-ethyl-2-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(CC)=C(C2=NC(C)(C)CO2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H27N3O5/c1-6-16-19(20-24-22(4,5)12-30-20)18(14-9-8-10-15(11-14)25(27)28)17(13(3)23-16)21(26)29-7-2/h8-11,18,23H,6-7,12H2,1-5H3 |
| InChIKey | BFUFGAGSBHTRQF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|