C16H22N2O4S2 — CID 133266829
N-[(1S,5S,6R,7S)-7-(methanesulfonamido)-2-oxabicyclo[3.2.0]heptan-6-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 133266829) has the molecular formula C16H22N2O4S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-[(1S,5S,6R,7S)-7-(methanesulfonamido)-2-oxabicyclo[3.2.0]heptan-6-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-[(1S,5S,6R,7S)-7-(methanesulfonamido)-2-oxabicyclo[3.2.0]heptan-6-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 133266829 |
| Molecular Formula | C16H22N2O4S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | N-[(1S,5S,6R,7S)-7-(methanesulfonamido)-2-oxabicyclo[3.2.0]heptan-6-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CS(=O)(=O)N[C@H]1[C@H](NC(=O)c2csc3c2CCCC3)[C@@H]2CCO[C@@H]21 |
| InChI | InChI=1S/C16H22N2O4S2/c1-24(20,21)18-14-13(10-6-7-22-15(10)14)17-16(19)11-8-23-12-5-3-2-4-9(11)12/h8,10,13-15,18H,2-7H2,1H3,(H,17,19)/t10-,13+,14-,15-/m0/s1 |
| InChIKey | LBAFNWYFQBQZFH-PUPMMZHASA-N |
| XLogP | 1.06 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |