C18H27NOS — CID 98465292
N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide (PubChem CID 98465292) has the molecular formula C18H27NOS and a molecular weight of 305.49 g/mol. Its IUPAC name is N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide.
| Compound Name | N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 98465292 |
| Molecular Formula | C18H27NOS |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@@H]1NC(=O)c1csc2c1CCCCC2 |
| InChI | InChI=1S/C18H27NOS/c1-12-7-6-9-16(13(12)2)19-18(20)15-11-21-17-10-5-3-4-8-14(15)17/h11-13,16H,3-10H2,1-2H3,(H,19,20)/t12-,13+,16+/m1/s1 |
| InChIKey | MIFJKEPQDQFLPH-WWGRRREGSA-N |
| XLogP | 4.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |