C17H25NO2S — CID 133267041
cis-(1R,3S)-3-hydroxy-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]cyclohexane-1-carboxamide (PubChem CID 133267041) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is cis-(1R,3S)-3-hydroxy-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,3S)-3-hydroxy-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 133267041 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | cis-(1R,3S)-3-hydroxy-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]cyclohexane-1-carboxamide |
| SMILES | Cc1ccccc1CSCCNC(=O)[C@@H]1CCC[C@H](O)C1 |
| InChI | InChI=1S/C17H25NO2S/c1-13-5-2-3-6-15(13)12-21-10-9-18-17(20)14-7-4-8-16(19)11-14/h2-3,5-6,14,16,19H,4,7-12H2,1H3,(H,18,20)/t14-,16+/m1/s1 |
| InChIKey | QHAHDJJWZBALOG-ZBFHGGJFSA-N |
| XLogP | 2.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|