C20H26N4O — CID 133267951
N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrazol-3-ylmethyl)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (PubChem CID 133267951) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrazol-3-ylmethyl)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide.
| Compound Name | N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrazol-3-ylmethyl)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 133267951 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrazol-3-ylmethyl)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| SMILES | O=C(NCC1NNC2CCCC21)c1cccc2c3c([nH]c12)CCCC3 |
| InChI | InChI=1S/C20H26N4O/c25-20(21-11-18-14-7-4-10-17(14)23-24-18)15-8-3-6-13-12-5-1-2-9-16(12)22-19(13)15/h3,6,8,14,17-18,22-24H,1-2,4-5,7,9-11H2,(H,21,25) |
| InChIKey | JZOWZOJHKMJAMT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|