C18H19ClN4O3 — CID 133270010
1-(4-chloro-2-nitrophenyl)-N-(6-methyl-2-pyridinyl)piperidine-3-carboxamide (PubChem CID 133270010) has the molecular formula C18H19ClN4O3 and a molecular weight of 374.83 g/mol. Its IUPAC name is 1-(4-chloro-2-nitrophenyl)-N-(6-methyl-2-pyridinyl)piperidine-3-carboxamide.
| Compound Name | 1-(4-chloro-2-nitrophenyl)-N-(6-methyl-2-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133270010 |
| Molecular Formula | C18H19ClN4O3 |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 1-(4-chloro-2-nitrophenyl)-N-(6-methyl-2-pyridinyl)piperidine-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)C2CCCN(c3ccc(Cl)cc3[N+](=O)[O-])C2)n1 |
| InChI | InChI=1S/C18H19ClN4O3/c1-12-4-2-6-17(20-12)21-18(24)13-5-3-9-22(11-13)15-8-7-14(19)10-16(15)23(25)26/h2,4,6-8,10,13H,3,5,9,11H2,1H3,(H,20,21,24) |
| InChIKey | HKGVBFSKZOISPT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|