C14H18N2O3S — CID 133270595
3-(4-ethoxypiperidin-1-yl)-1,2-benzothiazole 1,1-dioxide (PubChem CID 133270595) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 3-(4-ethoxypiperidin-1-yl)-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 3-(4-ethoxypiperidin-1-yl)-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 133270595 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3-(4-ethoxypiperidin-1-yl)-1,2-benzothiazole 1,1-dioxide |
| SMILES | CCOC1CCN(C2=NS(=O)(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C14H18N2O3S/c1-2-19-11-7-9-16(10-8-11)14-12-5-3-4-6-13(12)20(17,18)15-14/h3-6,11H,2,7-10H2,1H3 |
| InChIKey | HASNQJCFRUKGRG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |