C13H16N2O3S — CID 80701942
1-(1,1-dioxo-1,2-benzothiazol-3-yl)-4-methylpiperidin-4-ol (PubChem CID 80701942) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,2-benzothiazol-3-yl)-4-methylpiperidin-4-ol.
| Compound Name | 1-(1,1-dioxo-1,2-benzothiazol-3-yl)-4-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 80701942 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1-(1,1-dioxo-1,2-benzothiazol-3-yl)-4-methylpiperidin-4-ol |
| SMILES | CC1(O)CCN(C2=NS(=O)(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C13H16N2O3S/c1-13(16)6-8-15(9-7-13)12-10-4-2-3-5-11(10)19(17,18)14-12/h2-5,16H,6-9H2,1H3 |
| InChIKey | PQDLPZCNSFKZPQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |