C20H23F3N2O2 — CID 133272777
N-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 133272777) has the molecular formula C20H23F3N2O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is N-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 133272777 |
| Molecular Formula | C20H23F3N2O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[[4-(2-methoxy-5-methylphenyl)oxan-4-yl]methyl]-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | COc1ccc(C)cc1C1(CNc2ncccc2C(F)(F)F)CCOCC1 |
| InChI | InChI=1S/C20H23F3N2O2/c1-14-5-6-17(26-2)16(12-14)19(7-10-27-11-8-19)13-25-18-15(20(21,22)23)4-3-9-24-18/h3-6,9,12H,7-8,10-11,13H2,1-2H3,(H,24,25) |
| InChIKey | SEBZLTHAOBDMPC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |