C17H14F3N3O3 — CID 133274731
3-nitro-4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethylamino]benzonitrile (PubChem CID 133274731) has the molecular formula C17H14F3N3O3 and a molecular weight of 365.31 g/mol. Its IUPAC name is 3-nitro-4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethylamino]benzonitrile.
| Compound Name | 3-nitro-4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethylamino]benzonitrile |
|---|---|
| PubChem CID | 133274731 |
| Molecular Formula | C17H14F3N3O3 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 3-nitro-4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethylamino]benzonitrile |
| SMILES | CC(Nc1ccc(C#N)cc1[N+](=O)[O-])c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F3N3O3/c1-11(13-3-5-14(6-4-13)26-10-17(18,19)20)22-15-7-2-12(9-21)8-16(15)23(24)25/h2-8,11,22H,10H2,1H3 |
| InChIKey | RLEGLDGVRQFTCP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|