C20H20N6S2 — CID 133275310
4-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-pyridin-3-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine (PubChem CID 133275310) has the molecular formula C20H20N6S2 and a molecular weight of 408.56 g/mol. Its IUPAC name is 4-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-pyridin-3-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine.
| Compound Name | 4-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-pyridin-3-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 133275310 |
| Molecular Formula | C20H20N6S2 |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 4-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-pyridin-3-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
| SMILES | CCn1c(C)nnc1Sc1nc(-c2cccnc2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C20H20N6S2/c1-3-26-12(2)24-25-20(26)28-19-16-14-8-4-5-9-15(14)27-18(16)22-17(23-19)13-7-6-10-21-11-13/h6-7,10-11H,3-5,8-9H2,1-2H3 |
| InChIKey | JPPRBLSETRHRBZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |