C19H19N7S2 — CID 133275285
4-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine (PubChem CID 133275285) has the molecular formula C19H19N7S2 and a molecular weight of 409.54 g/mol. Its IUPAC name is 4-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine.
| Compound Name | 4-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 133275285 |
| Molecular Formula | C19H19N7S2 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 4-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
| SMILES | CCn1c(C)nnc1Sc1nc(-c2cnccn2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C19H19N7S2/c1-3-26-11(2)24-25-19(26)28-18-15-12-6-4-5-7-14(12)27-17(15)22-16(23-18)13-10-20-8-9-21-13/h8-10H,3-7H2,1-2H3 |
| InChIKey | BTDDOAWYFGUNMJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |